cas: 169036-71-9 — see every product listed under this CAS number, including other names
1-(4-Fluoro-phenyl)-1 H -pyrrole-2-carbaldehyde, 98% (CAS 169036-71-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F031499-100MG |
| cas | 169036-71-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 1g | 830.98 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-fluorophenyl)pyrrole-2-carbaldehyde (CAS 169036-71-9) is a chemical compound with the molecular formula C11H8FNO and a molecular weight of 189.19 g/mol. IUPAC name: 1-(4-fluorophenyl)pyrrole-2-carbaldehyde. InChIKey: JDANDWLVCIKGCA-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO |
|---|---|
| Molecular weight | 189.19 g/mol |
| IUPAC name | 1-(4-fluorophenyl)pyrrole-2-carbaldehyde |
| InChIKey | JDANDWLVCIKGCA-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=C1)C=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)