Products 1337843-56-7
CAS 1337843-56-7 is the registry number for 4-Fluoro-6-oxo-5,6,7,8-tetrahydronaphthalene-2-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-6-oxo-7,8-dihydro-5H-naphthalene-2-carbonitrile (CAS 1337843-56-7) is a chemical compound with the molecular formula C11H8FNO and a molecular weight of 189.19 g/mol. IUPAC name: 4-fluoro-6-oxo-7,8-dihydro-5H-naphthalene-2-carbonitrile. InChIKey: ZDZIPGIUOGHMER-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO |
|---|---|
| Molecular weight | 189.19 g/mol |
| IUPAC name | 4-fluoro-6-oxo-7,8-dihydro-5H-naphthalene-2-carbonitrile |
| InChIKey | ZDZIPGIUOGHMER-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1=O)C(=CC(=C2)C#N)F |
Computed by PubChem (NCBI)