cas: 915921-31-2 — see every product listed under this CAS number, including other names
1-(4-Fluorophenyl)-2,2-dimethylcyclopropanecarboxylic acid, 95%+, 95%+ (CAS 915921-31-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117GL5-100mg |
| cas | 915921-31-2 |
| size | 100mg |
| availability | 1.83g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 645.20 Pln | |
| Chemat | 500mg | 1125.20 Pln | |
| Chemat | 1g | 1691.60 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
1-(4-fluorophenyl)-2,2-dimethylcyclopropane-1-carboxylic acid (CAS 915921-31-2) is a chemical compound with the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. IUPAC name: 1-(4-fluorophenyl)-2,2-dimethylcyclopropane-1-carboxylic acid. InChIKey: RIOYANNPRFBSNF-UHFFFAOYSA-N.
| Molecular formula | C12H13FO2 |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| InChIKey | RIOYANNPRFBSNF-UHFFFAOYSA-N |
| SMILES | CC1(CC1(C2=CC=C(C=C2)F)C(=O)O)C |
Computed by PubChem (NCBI)