CAS 915921-31-2 appears in our catalog under these names: 1-(4-Fluorophenyl)-2,2-dimethylcyclopropanecarboxylic acid, 95%, 1-(4-Fluorophenyl)-2,2-dimethyl-cyclopropanecarboxylic Acid, 1–(4–fluorophenyl)–2,2–dimethylcyclopropane–1–carboxylic acid, 1-(4-Fluorophenyl)-2,2-dimethylcyclopropanecarboxylic acid, 95%+, 95%+, 1-(4-fluorophenyl)-2,2-dimethylcyclopropanecarboxylic acid, 90%. Offered by: Combi-blocks, TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 500mg.
1-(4-fluorophenyl)-2,2-dimethylcyclopropane-1-carboxylic acid (CAS 915921-31-2) is a chemical compound with the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. IUPAC name: 1-(4-fluorophenyl)-2,2-dimethylcyclopropane-1-carboxylic acid. InChIKey: RIOYANNPRFBSNF-UHFFFAOYSA-N.
| Molecular formula | C12H13FO2 |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| InChIKey | RIOYANNPRFBSNF-UHFFFAOYSA-N |
| SMILES | CC1(CC1(C2=CC=C(C=C2)F)C(=O)O)C |
Computed by PubChem (NCBI)