cas: 24522-49-4 — see every product listed under this CAS number, including other names
1-(4-Fluorophenyl)-4,6-dimethyl-2-oxo-1,2-dihydropyridine-3-carbonitrile, >97%, >97% (CAS 24522-49-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113OEJ-5g |
| cas | 24522-49-4 |
| size | 5g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 914.00 Pln | |
| Chemat | 25g | 2872.40 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
3-benzyl-3-azabicyclo[3.1.1]heptan-6-one (CAS 24522-49-4) is a chemical compound with the molecular formula C13H15NO and a molecular weight of 201.26 g/mol. IUPAC name: 3-benzyl-3-azabicyclo[3.1.1]heptan-6-one. InChIKey: DXLWDHDUFRJNJZ-UHFFFAOYSA-N.
| Molecular formula | C13H15NO |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | 3-benzyl-3-azabicyclo[3.1.1]heptan-6-one |
| InChIKey | DXLWDHDUFRJNJZ-UHFFFAOYSA-N |
| SMILES | C1C2CN(CC1C2=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)