Products 82606-90-4
CAS 82606-90-4 is the registry number for (1E,4E)-1-(Dimethylamino)-5-phenylpenta-1,4-dien-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(1E,4E)-1-(dimethylamino)-5-phenylpenta-1,4-dien-3-one (CAS 82606-90-4) is a chemical compound with the molecular formula C13H15NO and a molecular weight of 201.26 g/mol. IUPAC name: (1E,4E)-1-(dimethylamino)-5-phenylpenta-1,4-dien-3-one. InChIKey: CPAPAUUVHVLWMO-BNFZFUHLSA-N.
| Molecular formula | C13H15NO |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | (1E,4E)-1-(dimethylamino)-5-phenylpenta-1,4-dien-3-one |
| InChIKey | CPAPAUUVHVLWMO-BNFZFUHLSA-N |
| SMILES | CN(C)/C=C/C(=O)/C=C/C1=CC=CC=C1 |
Computed by PubChem (NCBI)