cas: 6338-81-4 — see every product listed under this CAS number, including other names
1-(4-Hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one, ≥97%, ≥97% (CAS 6338-81-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EE7N-1g |
| cas | 6338-81-4 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 275.60 Pln | |
| Chemat | 25g | 2536.40 Pln | |
| Chemat | 5g | 731.60 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
(E)-1-(4-hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one (CAS 6338-81-4) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: (E)-1-(4-hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one. InChIKey: RTCVAWRRHHSOCC-NYYWCZLTSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | (E)-1-(4-hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one |
| InChIKey | RTCVAWRRHHSOCC-NYYWCZLTSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)