Products 6272-45-3
CAS 6272-45-3 appears in our catalog under these names: 3–(4–(Benzyloxy)Phenyl)Acrylic Acid, 3-[4-(Benzyloxy)phenyl]acrylic acid, 98%, 3-(4-(Benzyloxy)phenyl)acrylic acid 98%, 3-(4-(Benzyloxy)phenyl)acrylic acid, 98%, 98%, (E)-3-(4-(Benzyloxy)phenyl)acrylic acid, 98%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100g, 25g, 250mg, 10g.
(E)-3-(4-phenylmethoxyphenyl)prop-2-enoic acid (CAS 6272-45-3) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: (E)-3-(4-phenylmethoxyphenyl)prop-2-enoic acid. InChIKey: HCMSDYVKYZIYGA-DHZHZOJOSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | (E)-3-(4-phenylmethoxyphenyl)prop-2-enoic acid |
| InChIKey | HCMSDYVKYZIYGA-DHZHZOJOSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2E)-3-[4-(benzyloxy)phenyl]prop-2-enoic acid, 3-(4-Benzyloxy-phenyl)-acrylic acid, (2E)-3-(4-(benzyloxy)phenyl)prop-2-enoic acid, (E)-3-(4-(Benzyloxy)phenyl)acrylic acid, 3-[4-(benzyloxy)phenyl]acrylic acid, 3-(4-(Benzyloxy)phenyl)acrylic acid, 3-[4-(Benzyloxy)phenyl]prop-2-enoic acid, (E)-3-(4-phenylmethoxyphenyl)prop-2-enoic acid, 3-[4-(phenylmethoxy)phenyl]-2-propenoic acid, orb2276614