cas: 220141-75-3 — see every product listed under this CAS number, including other names
1-(4-Methoxy-2-(trifluoromethyl)phenyl)ethanone, 98% (CAS 220141-75-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F334412-1G |
| cas | 220141-75-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 247.85 Pln | |
| Fluorochem | 10g | 440.49 Pln | |
| Fluorochem | 25g | 872.63 Pln | |
| Fluorochem | 100g | 3283.24 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-[4-methoxy-2-(trifluoromethyl)phenyl]ethanone (CAS 220141-75-3) is a chemical compound with the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. IUPAC name: 1-[4-methoxy-2-(trifluoromethyl)phenyl]ethanone. InChIKey: RSUCOEPTFURXML-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O2 |
|---|---|
| Molecular weight | 218.17 g/mol |
| IUPAC name | 1-[4-methoxy-2-(trifluoromethyl)phenyl]ethanone |
| InChIKey | RSUCOEPTFURXML-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)OC)C(F)(F)F |
Computed by PubChem (NCBI)