cas: 149105-10-2 — see every product listed under this CAS number, including other names
1-(4-Methoxy-3-(trifluoromethyl)phenyl)ethanone 98% (CAS 149105-10-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A682692-1g |
| cas | 149105-10-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 25g | 960.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A682692 |
1-[4-methoxy-3-(trifluoromethyl)phenyl]ethanone (CAS 149105-10-2) is a chemical compound with the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. IUPAC name: 1-[4-methoxy-3-(trifluoromethyl)phenyl]ethanone. InChIKey: ABUSWLOUSQWWLA-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O2 |
|---|---|
| Molecular weight | 218.17 g/mol |
| IUPAC name | 1-[4-methoxy-3-(trifluoromethyl)phenyl]ethanone |
| InChIKey | ABUSWLOUSQWWLA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)OC)C(F)(F)F |
Computed by PubChem (NCBI)