cas: 5044-27-9 — see every product listed under this CAS number, including other names
1-(4-Methoxyphenyl)-2,5-dimethyl-1H-pyrrole, ≥95%, ≥95% (CAS 5044-27-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DE6E-1g |
| cas | 5044-27-9 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 3198.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-(4-methoxyphenyl)-2,5-dimethylpyrrole (CAS 5044-27-9) is a chemical compound with the molecular formula C13H15NO and a molecular weight of 201.26 g/mol. IUPAC name: 1-(4-methoxyphenyl)-2,5-dimethylpyrrole. InChIKey: ZJXMRHDTQFPICU-UHFFFAOYSA-N.
| Molecular formula | C13H15NO |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-2,5-dimethylpyrrole |
| InChIKey | ZJXMRHDTQFPICU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC=C(C=C2)OC)C |
Computed by PubChem (NCBI)