CAS 71209-71-7 appears in our catalog under these names: 4'-tert-Butylpropiophenone, 95%, 1-(4-(tert-Butyl)phenyl)propan-1-one, 98%, Butylpropiophenone, 4'-tert-Butylpropiophenone, >95.0%(GC). Offered by: Combi-blocks, AmBeed, GLPBio, TCI. Available pack sizes: 5g, 1g, 1ml, 5ml.
1-(4-tert-butylphenyl)propan-1-one (CAS 71209-71-7) is a chemical compound with the molecular formula C13H18O and a molecular weight of 190.28 g/mol. IUPAC name: 1-(4-tert-butylphenyl)propan-1-one. InChIKey: AQNYEAINONORRY-UHFFFAOYSA-N.
| Molecular formula | C13H18O |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)propan-1-one |
| InChIKey | AQNYEAINONORRY-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC=C(C=C1)C(C)(C)C |
Computed by PubChem (NCBI)