CAS 66390-56-5 appears in our catalog under these names: 2',2,2,5'-Tetramethylpropiophenone, 95%, 2',2,2,5'–Tetramethylpropiophenone. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 10g, 5g, 1g, 250mg.
1-(2,5-dimethylphenyl)-2,2-dimethylpropan-1-one (CAS 66390-56-5) is a chemical compound with the molecular formula C13H18O and a molecular weight of 190.28 g/mol. IUPAC name: 1-(2,5-dimethylphenyl)-2,2-dimethylpropan-1-one. InChIKey: RLPMIFXUCYUHTO-UHFFFAOYSA-N.
| Molecular formula | C13H18O |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | 1-(2,5-dimethylphenyl)-2,2-dimethylpropan-1-one |
| InChIKey | RLPMIFXUCYUHTO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C(=O)C(C)(C)C |
Computed by PubChem (NCBI)