cas: 871125-86-9 — see every product listed under this CAS number, including other names
1-(5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)piperazine (CAS 871125-86-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235445-250MG |
| cas | 871125-86-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1684.84 Pln | |
| Fluorochem | 5g | 3158.28 Pln | |
| Fluorochem | 100mg | 310.33 Pln |
| delivery time | 3-4 weeks |
|---|
1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine (CAS 871125-86-9) is a chemical compound with the molecular formula C15H24BN3O2 and a molecular weight of 289.18 g/mol. IUPAC name: 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine. InChIKey: MEHCIETYEUUYGC-UHFFFAOYSA-N.
| Molecular formula | C15H24BN3O2 |
|---|---|
| Molecular weight | 289.18 g/mol |
| IUPAC name | 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine |
| InChIKey | MEHCIETYEUUYGC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)N3CCNCC3 |
Computed by PubChem (NCBI)