CAS 1202805-22-8 is the registry number for 2-(Cyclopentylamino)pyrimidine-5-boronic acid, pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (CAS 1202805-22-8) is a chemical compound with the molecular formula C15H24BN3O2 and a molecular weight of 289.18 g/mol. IUPAC name: N-cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine. InChIKey: AEHCJEOTWNMLFO-UHFFFAOYSA-N.
| Molecular formula | C15H24BN3O2 |
|---|---|
| Molecular weight | 289.18 g/mol |
| IUPAC name | N-cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| InChIKey | AEHCJEOTWNMLFO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)NC3CCCC3 |
Computed by PubChem (NCBI)