cas: 306934-70-3 — see every product listed under this CAS number, including other names
1-(5-(Trifluoromethyl)pyridin-2-yl)-1,4-diazepane 97+% (CAS 306934-70-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A514276-250mg |
| cas | 306934-70-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 592.88 Pln |
| purity | 97+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A514276 |
1-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane (CAS 306934-70-3) is a chemical compound with the molecular formula C11H14F3N3 and a molecular weight of 245.24 g/mol. IUPAC name: 1-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane. InChIKey: IBMSHQVIAUTKDL-UHFFFAOYSA-N.
| Molecular formula | C11H14F3N3 |
|---|---|
| Molecular weight | 245.24 g/mol |
| IUPAC name | 1-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane |
| InChIKey | IBMSHQVIAUTKDL-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=NC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)