cas: 306934-70-3 — see every product listed under this CAS number, including other names
1-[5-(Trifluoromethyl)pyrid-2-yl]-1,4-diazepane, 97% (CAS 306934-70-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F017270-25G |
| cas | 306934-70-3 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 3501.91 Pln | |
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 5g | 914.28 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane (CAS 306934-70-3) is a chemical compound with the molecular formula C11H14F3N3 and a molecular weight of 245.24 g/mol. IUPAC name: 1-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane. InChIKey: IBMSHQVIAUTKDL-UHFFFAOYSA-N.
| Molecular formula | C11H14F3N3 |
|---|---|
| Molecular weight | 245.24 g/mol |
| IUPAC name | 1-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane |
| InChIKey | IBMSHQVIAUTKDL-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=NC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)