cas: 1704067-47-9 — see every product listed under this CAS number, including other names
1-(5-Bromo-2,3-difluorophenyl)pyrrolidine 95+% (CAS 1704067-47-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A831959-250mg |
| cas | 1704067-47-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 642.94 Pln | |
| Ambeed | 1g | 1282.62 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A831959 |
1-(5-bromo-2,3-difluorophenyl)pyrrolidine (CAS 1704067-47-9) is a chemical compound with the molecular formula C10H10BrF2N and a molecular weight of 262.09 g/mol. IUPAC name: 1-(5-bromo-2,3-difluorophenyl)pyrrolidine. InChIKey: XHFJMKVOEFNBAY-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF2N |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 1-(5-bromo-2,3-difluorophenyl)pyrrolidine |
| InChIKey | XHFJMKVOEFNBAY-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C(=CC(=C2)Br)F)F |
Computed by PubChem (NCBI)