cas: 1704067-47-9 — see every product listed under this CAS number, including other names
1-(5-broMo-2,3-difluorophenyl)pyrrolidine, 95%, 95% (CAS 1704067-47-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ARIU-250mg |
| cas | 1704067-47-9 |
| size | 250mg |
| availability | 5.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 486.80 Pln | |
| Chemat | 1g | 966.80 Pln | |
| Chemat | 5g | 3026.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(5-bromo-2,3-difluorophenyl)pyrrolidine (CAS 1704067-47-9) is a chemical compound with the molecular formula C10H10BrF2N and a molecular weight of 262.09 g/mol. IUPAC name: 1-(5-bromo-2,3-difluorophenyl)pyrrolidine. InChIKey: XHFJMKVOEFNBAY-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF2N |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 1-(5-bromo-2,3-difluorophenyl)pyrrolidine |
| InChIKey | XHFJMKVOEFNBAY-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C(=CC(=C2)Br)F)F |
Computed by PubChem (NCBI)