cas: 849021-44-9 — see every product listed under this CAS number, including other names
1-(5-Bromopyrimidin-2-yl)[1,4]diazepane (CAS 849021-44-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023589-1G |
| cas | 849021-44-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 674.78 Pln | |
| Fluorochem | 5g | 1924.34 Pln |
| delivery time | 2-3 weeks |
|---|
1-(5-bromopyrimidin-2-yl)-1,4-diazepane (CAS 849021-44-9) is a chemical compound with the molecular formula C9H13BrN4 and a molecular weight of 257.13 g/mol. IUPAC name: 1-(5-bromopyrimidin-2-yl)-1,4-diazepane. InChIKey: XKAYYTATJMNDJA-UHFFFAOYSA-N.
| Molecular formula | C9H13BrN4 |
|---|---|
| Molecular weight | 257.13 g/mol |
| IUPAC name | 1-(5-bromopyrimidin-2-yl)-1,4-diazepane |
| InChIKey | XKAYYTATJMNDJA-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)