CAS 1335051-33-6 appears in our catalog under these names: 5-Bromo-3-(piperazin-1-yl)pyridin-2-amine, 95%, 5–Bromo–3–(piperazin–1–yl)pyridin–2–amine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 10g.
5-bromo-3-piperazin-1-ylpyridin-2-amine (CAS 1335051-33-6) is a chemical compound with the molecular formula C9H13BrN4 and a molecular weight of 257.13 g/mol. IUPAC name: 5-bromo-3-piperazin-1-ylpyridin-2-amine. InChIKey: BYYVMVYCARVHND-UHFFFAOYSA-N.
| Molecular formula | C9H13BrN4 |
|---|---|
| Molecular weight | 257.13 g/mol |
| IUPAC name | 5-bromo-3-piperazin-1-ylpyridin-2-amine |
| InChIKey | BYYVMVYCARVHND-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(N=CC(=C2)Br)N |
Computed by PubChem (NCBI)