cas: 1614255-25-2 — see every product listed under this CAS number, including other names
1-(6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl)ethanone, 98% (CAS 1614255-25-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F758278-50MG |
| cas | 1614255-25-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 1096.51 Pln | |
| Fluorochem | 100mg | 1778.56 Pln | |
| Fluorochem | 250mg | 2918.78 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]ethanone (CAS 1614255-25-2) is a chemical compound with the molecular formula C18H21BO3 and a molecular weight of 296.2 g/mol. IUPAC name: 1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]ethanone. InChIKey: JKKBVDUBGMNAAD-UHFFFAOYSA-N.
| Molecular formula | C18H21BO3 |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]ethanone |
| InChIKey | JKKBVDUBGMNAAD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=C(C=C3)C(=O)C |
Computed by PubChem (NCBI)