CAS 864772-18-9 appears in our catalog under these names: 4,4,5,5–Tetramethyl–2–(3–phenoxyphenyl)–1,3,2–dioxaborolane, 4,4,5,5-Tetramethyl-2-(3-phenoxyphenyl),-1,3,2-dioxaborolane, 95%, 95%, 4,4,5,5-Tetramethyl-2-(3-phenoxyphenyl)-1,3,2-dioxaborolane, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
4,4,5,5-tetramethyl-2-(3-phenoxyphenyl)-1,3,2-dioxaborolane (CAS 864772-18-9) is a chemical compound with the molecular formula C18H21BO3 and a molecular weight of 296.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-phenoxyphenyl)-1,3,2-dioxaborolane. InChIKey: TUDMWVDLOSLEPT-UHFFFAOYSA-N.
| Molecular formula | C18H21BO3 |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-phenoxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | TUDMWVDLOSLEPT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)