cas: 153976-27-3 — see every product listed under this CAS number, including other names
1-(6-Bromopyridin-2-yl)-4-methylpiperazine (CAS 153976-27-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F770296-250MG |
| cas | 153976-27-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1080.89 Pln | |
| Fluorochem | 1g | 2580.36 Pln | |
| Fluorochem | 5g | 5214.85 Pln | |
| Fluorochem | 10g | 8635.52 Pln |
| delivery time | 3-4 weeks |
|---|
1-(6-bromo-2-pyridinyl)-4-methylpiperazine (CAS 153976-27-3) is a chemical compound with the molecular formula C10H14BrN3 and a molecular weight of 256.14 g/mol. IUPAC name: 1-(6-bromo-2-pyridinyl)-4-methylpiperazine. InChIKey: KEYDJYZYBWRMLD-UHFFFAOYSA-N.
| Molecular formula | C10H14BrN3 |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | 1-(6-bromo-2-pyridinyl)-4-methylpiperazine |
| InChIKey | KEYDJYZYBWRMLD-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC(=CC=C2)Br |
Computed by PubChem (NCBI)