CAS 1216000-02-0 is the registry number for 5-Bromo-2-N-cyclopentylpyridine-2,3-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-bromo-2-N-cyclopentylpyridine-2,3-diamine (CAS 1216000-02-0) is a chemical compound with the molecular formula C10H14BrN3 and a molecular weight of 256.14 g/mol. IUPAC name: 5-bromo-2-N-cyclopentylpyridine-2,3-diamine. InChIKey: LKJJDTHGHBFLEA-UHFFFAOYSA-N.
| Molecular formula | C10H14BrN3 |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | 5-bromo-2-N-cyclopentylpyridine-2,3-diamine |
| InChIKey | LKJJDTHGHBFLEA-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC2=C(C=C(C=N2)Br)N |
Computed by PubChem (NCBI)