cas: 94067-27-3 — see every product listed under this CAS number, including other names
1-(7-(Benzyloxy)-1H-indol-3-yl)-N,N-dimethylmethanamine 98% (CAS 94067-27-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A478120-100mg |
| cas | 94067-27-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 364.81 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1482.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A478120 |
N,N-dimethyl-1-(7-phenylmethoxy-1H-indol-3-yl)methanamine (CAS 94067-27-3) is a chemical compound with the molecular formula C18H20N2O and a molecular weight of 280.4 g/mol. IUPAC name: N,N-dimethyl-1-(7-phenylmethoxy-1H-indol-3-yl)methanamine. InChIKey: SUZMCIRGERDWMV-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | N,N-dimethyl-1-(7-phenylmethoxy-1H-indol-3-yl)methanamine |
| InChIKey | SUZMCIRGERDWMV-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CNC2=C1C=CC=C2OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)