Products 1335042-30-2
CAS 1335042-30-2 is the registry number for 3-{4-[(Piperidin-1-yl)carbonyl]phenyl}aniline, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[4-(3-aminophenyl)phenyl]-piperidin-1-ylmethanone (CAS 1335042-30-2) is a chemical compound with the molecular formula C18H20N2O and a molecular weight of 280.4 g/mol. IUPAC name: [4-(3-aminophenyl)phenyl]-piperidin-1-ylmethanone. InChIKey: MDPACWIAAZKTAA-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | [4-(3-aminophenyl)phenyl]-piperidin-1-ylmethanone |
| InChIKey | MDPACWIAAZKTAA-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CC=C(C=C2)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)