1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13,16-pentaoxa-4-azaoctadecan-18-oic acid, 98%, 98%
cas: 437655-95-3 — see every product listed under this CAS number, including other names
1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13,16-pentaoxa-4-azaoctadecan-18-oic acid, 98%, 98% (CAS 437655-95-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 50g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DHPD-100mg |
| cas | 437655-95-3 |
| size | 100mg |
| availability | 1000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 683.60 Pln | |
| Chemat | 10g | 1029.20 Pln | |
| Chemat | 50g | 3506.00 Pln | |
| Chemat | 250g | 8915.60 Pln | |
| Chemat | 500g | 14889.60 Pln | |
| Chemat | 1kg | 28235.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 437655-95-3) is a chemical compound with the molecular formula C25H31NO8 and a molecular weight of 473.5 g/mol. IUPAC name: 2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: XPNLDOFYRFOXLR-UHFFFAOYSA-N.
| Molecular formula | C25H31NO8 |
|---|---|
| Molecular weight | 473.5 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | XPNLDOFYRFOXLR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCOCCOCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-NH-PEG4-CH2COOH, 1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13,16-pentaoxa-4-azaoctadecan-18-oic acid, Fmoc-NH-PEG4-CH2CO2H, 5,8,11,14-Tetraoxa-2-azahexadecanedioic acid, Fmoc-PEG4-ch2cooh, FmocNH-PEG4-CH2COOH, orb1909413, 5,8,11,14-Tetraoxa-2-azahexadecanedioicacid, 1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13,16-pentaoxa-4-azaoctadecan-18-oicacid, 5,8,11,14-Tetraoxa-2-azahexadecanedioic acid 1-(9H-fluoren-9-ylmethyl) ester