CAS 437655-95-3 appears in our catalog under these names: Fmoc-NH-peg4-CH2COOH, 96%, Fmoc–NH–PEG4–CH2COOH, Fmoc-NH-PEG4-CH2COOH 97%, 1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13,16-pentaoxa-4-azaoctadecan-18-oic acid, 98%, 98%, Fmoc-NH-PEG4-CH2COOH, 99.47%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5g, 250mg, 1g, 100mg, 25g, 100g, 10g, 50g.
2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 437655-95-3) is a chemical compound with the molecular formula C25H31NO8 and a molecular weight of 473.5 g/mol. IUPAC name: 2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: XPNLDOFYRFOXLR-UHFFFAOYSA-N.
| Molecular formula | C25H31NO8 |
|---|---|
| Molecular weight | 473.5 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | XPNLDOFYRFOXLR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCOCCOCC(=O)O |
Computed by PubChem (NCBI)