cas: 1809168-72-6 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-2-bromo-4,5-dimethylbenzene (CAS 1809168-72-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631761-1G |
| cas | 1809168-72-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2580.36 Pln | |
| Fluorochem | 5g | 7599.43 Pln |
| delivery time | 3-4 weeks |
|---|
1-bromo-4,5-dimethyl-2-phenylmethoxybenzene (CAS 1809168-72-6) is a chemical compound with the molecular formula C15H15BrO and a molecular weight of 291.18 g/mol. IUPAC name: 1-bromo-4,5-dimethyl-2-phenylmethoxybenzene. InChIKey: GYDSZIPQGGJINU-UHFFFAOYSA-N.
| Molecular formula | C15H15BrO |
|---|---|
| Molecular weight | 291.18 g/mol |
| IUPAC name | 1-bromo-4,5-dimethyl-2-phenylmethoxybenzene |
| InChIKey | GYDSZIPQGGJINU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)Br)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)