Products 2432848-89-8
CAS 2432848-89-8 appears in our catalog under these names: 2-Bromo-4-(4-methoxybenzyl)-1-methylbenzene, 95%, 2-Bromo-4-(4-methoxybenzyl)-1-methylbenzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 500mg.
2-bromo-4-[(4-methoxyphenyl)methyl]-1-methylbenzene (CAS 2432848-89-8) is a chemical compound with the molecular formula C15H15BrO and a molecular weight of 291.18 g/mol. IUPAC name: 2-bromo-4-[(4-methoxyphenyl)methyl]-1-methylbenzene. InChIKey: TXMNKSIDSARJAT-UHFFFAOYSA-N.
| Molecular formula | C15H15BrO |
|---|---|
| Molecular weight | 291.18 g/mol |
| IUPAC name | 2-bromo-4-[(4-methoxyphenyl)methyl]-1-methylbenzene |
| InChIKey | TXMNKSIDSARJAT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CC2=CC=C(C=C2)OC)Br |
Computed by PubChem (NCBI)