cas: 148581-23-1 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-4-bromo-2,3-dimethylbenzene, 95+% (CAS 148581-23-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A337782-25g |
| cas | 148581-23-1 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 13272.28 Pln | |
| AmBeed | 10g | 6755.77 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-bromo-2,3-dimethyl-4-phenylmethoxybenzene (CAS 148581-23-1) is a chemical compound with the molecular formula C15H15BrO and a molecular weight of 291.18 g/mol. IUPAC name: 1-bromo-2,3-dimethyl-4-phenylmethoxybenzene. InChIKey: KUKQHKRFGDNZJY-UHFFFAOYSA-N.
| Molecular formula | C15H15BrO |
|---|---|
| Molecular weight | 291.18 g/mol |
| IUPAC name | 1-bromo-2,3-dimethyl-4-phenylmethoxybenzene |
| InChIKey | KUKQHKRFGDNZJY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C)Br)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)