cas: 1044067-73-3 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-4-chloro-2-fluorobenzene, 95-<97% (CAS 1044067-73-3) is a chemical reagent available from Chemat. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC5426-95-97-2.5g |
| cas | 1044067-73-3 |
| size | 2,5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 2,5g | 3676.64 Pln | |
| Hoffman Fine Chemicals | 5g | 6337.10 Pln | |
| Hoffman Fine Chemicals | 10g | 10547.90 Pln | |
| Hoffman Fine Chemicals | 25g | 20436.90 Pln | |
| Hoffman Fine Chemicals | 50g | 32514.24 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
4-chloro-2-fluoro-1-phenylmethoxybenzene (CAS 1044067-73-3) is a chemical compound with the molecular formula C13H10ClFO and a molecular weight of 236.67 g/mol. IUPAC name: 4-chloro-2-fluoro-1-phenylmethoxybenzene. InChIKey: SKWOKOIDIZNZOX-UHFFFAOYSA-N.
| Molecular formula | C13H10ClFO |
|---|---|
| Molecular weight | 236.67 g/mol |
| IUPAC name | 4-chloro-2-fluoro-1-phenylmethoxybenzene |
| InChIKey | SKWOKOIDIZNZOX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)Cl)F |
Computed by PubChem (NCBI)