Products 2795-76-8
CAS 2795-76-8 appears in our catalog under these names: (4-Chlorophenyl)(4-fluorophenyl)methanol, 98%, (4-Chlorophenyl)(4-fluorophenyl)methanol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g.
(4-chlorophenyl)-(4-fluorophenyl)methanol (CAS 2795-76-8) is a chemical compound with the molecular formula C13H10ClFO and a molecular weight of 236.67 g/mol. IUPAC name: (4-chlorophenyl)-(4-fluorophenyl)methanol. InChIKey: JCIWCQYNVZQYRV-UHFFFAOYSA-N.
| Molecular formula | C13H10ClFO |
|---|---|
| Molecular weight | 236.67 g/mol |
| IUPAC name | (4-chlorophenyl)-(4-fluorophenyl)methanol |
| InChIKey | JCIWCQYNVZQYRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)Cl)O)F |
Computed by PubChem (NCBI)