CAS 82657-76-9 is the registry number for 1-(Bromomethyl)-3-(methylsulfonyl)benzene, 95%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(bromomethyl)-3-methylsulfonylbenzene (CAS 82657-76-9) is a chemical compound with the molecular formula C8H9BrO2S and a molecular weight of 249.13 g/mol. IUPAC name: 1-(bromomethyl)-3-methylsulfonylbenzene. InChIKey: JRXBZWXKAYJVRI-UHFFFAOYSA-N.
| Molecular formula | C8H9BrO2S |
|---|---|
| Molecular weight | 249.13 g/mol |
| IUPAC name | 1-(bromomethyl)-3-methylsulfonylbenzene |
| InChIKey | JRXBZWXKAYJVRI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)CBr |
Computed by PubChem (NCBI)