CAS 859489-84-2 is the registry number for Methyl 4-bromo-2,5-dimethylthiophene-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 4-bromo-2,5-dimethylthiophene-3-carboxylate (CAS 859489-84-2) is a chemical compound with the molecular formula C8H9BrO2S and a molecular weight of 249.13 g/mol. IUPAC name: methyl 4-bromo-2,5-dimethylthiophene-3-carboxylate. InChIKey: NETOWRBCJFGUHN-UHFFFAOYSA-N.
| Molecular formula | C8H9BrO2S |
|---|---|
| Molecular weight | 249.13 g/mol |
| IUPAC name | methyl 4-bromo-2,5-dimethylthiophene-3-carboxylate |
| InChIKey | NETOWRBCJFGUHN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(S1)C)Br)C(=O)OC |
Computed by PubChem (NCBI)