cas: 40517-43-9 — see every product listed under this CAS number, including other names
1-(Chloromethyl)-4-(methylsulfonyl)benzene 98% (CAS 40517-43-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A620582-5g |
| cas | 40517-43-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 25g | 665.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A620582 |
1-(chloromethyl)-4-methylsulfonylbenzene (CAS 40517-43-9) is a chemical compound with the molecular formula C8H9ClO2S and a molecular weight of 204.67 g/mol. IUPAC name: 1-(chloromethyl)-4-methylsulfonylbenzene. InChIKey: LXPRVXKHIXWBJZ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO2S |
|---|---|
| Molecular weight | 204.67 g/mol |
| IUPAC name | 1-(chloromethyl)-4-methylsulfonylbenzene |
| InChIKey | LXPRVXKHIXWBJZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)CCl |
Computed by PubChem (NCBI)