CAS 40517-43-9 appears in our catalog under these names: P-(Methylsulfonyl)benzyl chloride, 98%, 1-(Chloromethyl)-4-(methylsulfonyl)benzene 98%, 4-(Methylsulfonyl)benzyl chloride, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 100g, 5g, 25g.
1-(chloromethyl)-4-methylsulfonylbenzene (CAS 40517-43-9) is a chemical compound with the molecular formula C8H9ClO2S and a molecular weight of 204.67 g/mol. IUPAC name: 1-(chloromethyl)-4-methylsulfonylbenzene. InChIKey: LXPRVXKHIXWBJZ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO2S |
|---|---|
| Molecular weight | 204.67 g/mol |
| IUPAC name | 1-(chloromethyl)-4-methylsulfonylbenzene |
| InChIKey | LXPRVXKHIXWBJZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)CCl |
Computed by PubChem (NCBI)