cas: 17281-59-3 — see every product listed under this CAS number, including other names
1-(Cyanomethyl)pyridin-1-ium chloride, 98% (CAS 17281-59-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633647-1G |
| cas | 17281-59-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 25g | 357.18 Pln | |
| Fluorochem | 100g | 1065.27 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-pyridin-1-ium-1-ylacetonitrile chloride (CAS 17281-59-3) is a chemical compound with the molecular formula C7H7ClN2 and a molecular weight of 154.60 g/mol. IUPAC name: 2-pyridin-1-ium-1-ylacetonitrile chloride. InChIKey: HEJOROWXIWLCMS-UHFFFAOYSA-M.
| Molecular formula | C7H7ClN2 |
|---|---|
| Molecular weight | 154.60 g/mol |
| IUPAC name | 2-pyridin-1-ium-1-ylacetonitrile chloride |
| InChIKey | HEJOROWXIWLCMS-UHFFFAOYSA-M |
| SMILES | C1=CC=[N+](C=C1)CC#N.[Cl-] |
Computed by PubChem (NCBI)