cas: 69159-50-8 — see every product listed under this CAS number, including other names
1-(Dibenzosuberyl)-piperazine (CAS 69159-50-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009765-250MG |
| cas | 69159-50-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 2g | 825.77 Pln |
| delivery time | 2-3 weeks |
|---|
1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperazine (CAS 69159-50-8) is a chemical compound with the molecular formula C19H22N2 and a molecular weight of 278.4 g/mol. IUPAC name: 1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperazine. InChIKey: MDBCLUYDTRHKCA-UHFFFAOYSA-N.
| Molecular formula | C19H22N2 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | 1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperazine |
| InChIKey | MDBCLUYDTRHKCA-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2C(C3=CC=CC=C31)N4CCNCC4 |
Computed by PubChem (NCBI)