CAS 637325-09-8 appears in our catalog under these names: 1-(4-Isopropylbenzyl)-5,6-dimethyl-1h-benzimidazole, 95%, 5,6-Dimethyl-1-{(4-(propan-2-yl)phenyl)methyl}-1H-1,3-benzodiazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5,6-dimethyl-1-[(4-propan-2-ylphenyl)methyl]benzimidazole (CAS 637325-09-8) is a chemical compound with the molecular formula C19H22N2 and a molecular weight of 278.4 g/mol. IUPAC name: 5,6-dimethyl-1-[(4-propan-2-ylphenyl)methyl]benzimidazole. InChIKey: FUISTPWDJJENSI-UHFFFAOYSA-N.
| Molecular formula | C19H22N2 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | 5,6-dimethyl-1-[(4-propan-2-ylphenyl)methyl]benzimidazole |
| InChIKey | FUISTPWDJJENSI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N(C=N2)CC3=CC=C(C=C3)C(C)C |
Computed by PubChem (NCBI)