cas: 2179072-33-2 — see every product listed under this CAS number, including other names
1-(Fluorosulfonyl)-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate, 98%, 98% (CAS 2179072-33-2) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1kg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K46F-500g |
| cas | 2179072-33-2 |
| size | 500g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500g | 6057.60 Pln | |
| Chemat | 1kg | 7926.80 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 10g | 246.80 Pln | |
| Chemat | 25g | 462.80 Pln | |
| Chemat | 50g | 842.00 Pln | |
| Chemat | 100g | 1576.40 Pln | |
| Chemat | 250g | 3506.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate (CAS 2179072-33-2) is a chemical compound with the molecular formula C6H8F4N2O5S2 and a molecular weight of 328.3 g/mol. IUPAC name: 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate. InChIKey: YAZBWGHMIMMBFC-UHFFFAOYSA-M.
| Molecular formula | C6H8F4N2O5S2 |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate |
| InChIKey | YAZBWGHMIMMBFC-UHFFFAOYSA-M |
| SMILES | CC1=[N+](C=CN1S(=O)(=O)F)C.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)