cas: 2179072-33-2 — see every product listed under this CAS number, including other names
3-(Fluorosulfonyl)-1,2-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate, 97% (CAS 2179072-33-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F982632-250MG |
| cas | 2179072-33-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 96.86 Pln | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 10g | 383.22 Pln | |
| Fluorochem | 25g | 758.08 Pln | |
| Fluorochem | 100g | 2840.68 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate (CAS 2179072-33-2) is a chemical compound with the molecular formula C6H8F4N2O5S2 and a molecular weight of 328.3 g/mol. IUPAC name: 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate. InChIKey: YAZBWGHMIMMBFC-UHFFFAOYSA-M.
| Molecular formula | C6H8F4N2O5S2 |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate |
| InChIKey | YAZBWGHMIMMBFC-UHFFFAOYSA-M |
| SMILES | CC1=[N+](C=CN1S(=O)(=O)F)C.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)