CAS 1956-40-7 appears in our catalog under these names: Cinacalcet Impurity 74, 1-Acetylnaphthalene oxime, 95-<97%, 1–(Naphthalen–1–yl)ethanone oxime, 1-(1-Naphthalenyl)ethanone oxime, 98%, 98%. Offered by: Chemat Brand, Hoffman Fine Chemicals, GLPBio, Chemat. Available pack sizes: on request, 10g, 25g, 50g, 100g, 200g, 300g, 250mg.
(NE)-N-(1-naphthalen-1-ylethylidene)hydroxylamine (CAS 1956-40-7) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: (NE)-N-(1-naphthalen-1-ylethylidene)hydroxylamine. InChIKey: KHNGQTJKEPANSZ-UKTHLTGXSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | (NE)-N-(1-naphthalen-1-ylethylidene)hydroxylamine |
| InChIKey | KHNGQTJKEPANSZ-UKTHLTGXSA-N |
| SMILES | C/C(=N\O)/C1=CC=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)