1-(Phenylsulfonyl)-1H-indole-3-sulfonyl chloride, 98+%
cas: 535930-73-5 — see every product listed under this CAS number, including other names
1-(Phenylsulfonyl)-1H-indole-3-sulfonyl chloride, 98+% (CAS 535930-73-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A516708-250mg |
| cas | 535930-73-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 587.31 Pln | |
| Ambeed | 1g | 770.88 Pln | |
| Ambeed | 5g | 2511.94 Pln | |
| BLDpharm | 100mg | 458.75 Pln | |
| BLDpharm | 250mg | 569.82 Pln | |
| BLDpharm | 1g | 753.09 Pln | |
| BLDpharm | 5g | 2458.05 Pln | |
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 558.80 Pln | |
| Chemat | 1g | 736.40 Pln | |
| Chemat | 5g | 2421.20 Pln |
properties
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
1-(benzenesulfonyl)indole-3-sulfonyl chloride (CAS 535930-73-5) is a chemical compound with the molecular formula C14H10ClNO4S2 and a molecular weight of 355.8 g/mol. IUPAC name: 1-(benzenesulfonyl)indole-3-sulfonyl chloride. InChIKey: RZOOMEPNEVZRIT-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO4S2 |
|---|---|
| Molecular weight | 355.8 g/mol |
| IUPAC name | 1-(benzenesulfonyl)indole-3-sulfonyl chloride |
| InChIKey | RZOOMEPNEVZRIT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=CC=CC=C32)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
1-(Benzenesulfonyl)-1H-indole-3-sulfonyl chloride, 1-(Phenylsulfonyl)indole-3-sulfonyl chloride, 1-(Phenylsulfonyl)-1H-indole-3-sulfonyl chloride, 1-(benzenesulfonyl)indole-3-sulfonyl chloride, 1-(Phenylsulfonyl)-1H-indole-3-sulfonylchloride, 1H-Indole-3-sulfonyl chloride, 1-(phenylsulfonyl)-