CAS 85953-39-5 appears in our catalog under these names: 1–(Phenylsulfonyl)–1H–indole–2–sulfonyl chloride, 1-(Phenylsulfonyl)-1H-indole-2-sulfonyl chloride, 97%, 97%, 1-(Phenylsulfonyl)-1H-indole-2-sulfonyl chloride, 97%, 1-BENZENESULFONYL-1H-INDOLE-2-SULFONYL CHLORIDE, 97%. Offered by: GLPBio, Chemat, Ambeed, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
1-(benzenesulfonyl)indole-2-sulfonyl chloride (CAS 85953-39-5) is a chemical compound with the molecular formula C14H10ClNO4S2 and a molecular weight of 355.8 g/mol. IUPAC name: 1-(benzenesulfonyl)indole-2-sulfonyl chloride. InChIKey: VBZLCEHJLXBBHR-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO4S2 |
|---|---|
| Molecular weight | 355.8 g/mol |
| IUPAC name | 1-(benzenesulfonyl)indole-2-sulfonyl chloride |
| InChIKey | VBZLCEHJLXBBHR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C3=CC=CC=C3C=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)