cas: 1333344-24-3 — see every product listed under this CAS number, including other names
1-(Phenylsulfonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole 98% (CAS 1333344-24-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A962786-250mg |
| cas | 1333344-24-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1405.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A962786 |
1-(benzenesulfonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (CAS 1333344-24-3) is a chemical compound with the molecular formula C20H22BNO4S and a molecular weight of 383.3 g/mol. IUPAC name: 1-(benzenesulfonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole. InChIKey: HHTYBMQOVQCLET-UHFFFAOYSA-N.
| Molecular formula | C20H22BNO4S |
|---|---|
| Molecular weight | 383.3 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| InChIKey | HHTYBMQOVQCLET-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=CN3S(=O)(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)