cas: 1333344-24-3 — see every product listed under this CAS number, including other names
1-(Phenylsulfonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 97%, 97% (CAS 1333344-24-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1125OS-100mg |
| cas | 1333344-24-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 1605.20 Pln | |
| Chemat | 10g | 2632.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(benzenesulfonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (CAS 1333344-24-3) is a chemical compound with the molecular formula C20H22BNO4S and a molecular weight of 383.3 g/mol. IUPAC name: 1-(benzenesulfonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole. InChIKey: HHTYBMQOVQCLET-UHFFFAOYSA-N.
| Molecular formula | C20H22BNO4S |
|---|---|
| Molecular weight | 383.3 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| InChIKey | HHTYBMQOVQCLET-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=CN3S(=O)(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)