cas: 1450977-69-1 — see every product listed under this CAS number, including other names
1-(Pyrrolidin-1-yl)cyclopropane-1-carboxylic acid hydrochloride, 98% (CAS 1450977-69-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1067311-5g |
| cas | 1450977-69-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 31975.51 Pln | |
| AmBeed | 10g | 44754.64 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-pyrrolidin-1-ylcyclopropane-1-carboxylic acid;hydrochloride (CAS 1450977-69-1) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: 1-pyrrolidin-1-ylcyclopropane-1-carboxylic acid;hydrochloride. InChIKey: FSKGLNXDWJMTHD-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 1-pyrrolidin-1-ylcyclopropane-1-carboxylic acid;hydrochloride |
| InChIKey | FSKGLNXDWJMTHD-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2(CC2)C(=O)O.Cl |
Computed by PubChem (NCBI)