Products 68322-48-5

CAS 68322-48-5 is the registry number for Exo-8-azabicyclo[3.2.1]octane-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(1R,5S)-8-azabicyclo[3.2.1]octane-3-carboxylic acid;hydrochloride (CAS 68322-48-5) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: (1R,5S)-8-azabicyclo[3.2.1]octane-3-carboxylic acid;hydrochloride. InChIKey: MFAUMPVIUINZHM-FXFNDYDPSA-N.

Identity
Molecular formulaC8H14ClNO2
Molecular weight191.65 g/mol
IUPAC name(1R,5S)-8-azabicyclo[3.2.1]octane-3-carboxylic acid;hydrochloride
InChIKeyMFAUMPVIUINZHM-FXFNDYDPSA-N
SMILESC1C[C@H]2CC(C[C@@H]1N2)C(=O)O.Cl

Computed by PubChem (NCBI)